About 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate
2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate (PubChem CID 88690203) has the molecular formula C17H20N4O8
and a molecular weight of 408.37 g/mol. Its IUPAC name is 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate |
| PubChem CID | 88690203 |
| Molecular Formula | C17H20N4O8 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate |
| SMILES | O=C1c2ccc(OCCCN3CCCC3)c([N+](=O)[O-])c2C(=O)N1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O8/c22-16-12-4-5-13(28-10-3-8-18-6-1-2-7-18)15(20(24)25)14(12)17(23)19(16)9-11-29-21(26)27/h4-5H,1-3,6-11H2 |
| InChIKey | ZWCSXBOWTPTQPJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate?
The IUPAC name of 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate (CID 88690203) is 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate.
What is the SMILES notation for 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate?
The canonical SMILES for 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate is O=C1c2ccc(OCCCN3CCCC3)c([N+](=O)[O-])c2C(=O)N1CCO[N+](=O)[O-].
What is the InChIKey of 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate?
The InChIKey is ZWCSXBOWTPTQPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O8/c22-16-12-4-5-13(28-10-3-8-18-6-1-2-7-18)15(20(24)25)14(12)17(23)19(16)9-11-29-21(26)27/h4-5H,1-3,6-11H2.
What are the key properties of 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate?
2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate has a molecular weight of 408.37 g/mol, XLogP of 1.26, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-nitro-1,3-dioxo-5-(3-pyrrolidin-1-ylpropoxy)isoindol-2-yl]ethyl nitrate is sourced from PubChem (CID 88690203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).