C8H18O8S2 — CID 88690323
3-methyl-1,5,2,4-dioxadithiocane 2,2,4,4-tetraoxide;propane-1,3-diol (PubChem CID 88690323) has the molecular formula C8H18O8S2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-methyl-1,5,2,4-dioxadithiocane 2,2,4,4-tetraoxide;propane-1,3-diol.
| Compound Name | 3-methyl-1,5,2,4-dioxadithiocane 2,2,4,4-tetraoxide;propane-1,3-diol |
|---|---|
| PubChem CID | 88690323 |
| Molecular Formula | C8H18O8S2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-methyl-1,5,2,4-dioxadithiocane 2,2,4,4-tetraoxide;propane-1,3-diol |
| SMILES | CC1S(=O)(=O)OCCCOS1(=O)=O.OCCCO |
| InChI | InChI=1S/C5H10O6S2.C3H8O2/c1-5-12(6,7)10-3-2-4-11-13(5,8)9;4-2-1-3-5/h5H,2-4H2,1H3;4-5H,1-3H2 |
| InChIKey | CQEOZGNTXDFARZ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|