About (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine
(E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine (PubChem CID 88690426) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine |
| PubChem CID | 88690426 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine |
| SMILES | COC(C)CNC/C=C/N(C)C |
| InChI | InChI=1S/C9H20N2O/c1-9(12-4)8-10-6-5-7-11(2)3/h5,7,9-10H,6,8H2,1-4H3/b7-5+ |
| InChIKey | WKRKTXMYKZZMBW-FNORWQNLSA-N |
| XLogP | 0.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine?
The IUPAC name of (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine (CID 88690426) is (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine?
The canonical SMILES for (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine is COC(C)CNC/C=C/N(C)C.
What is the InChIKey of (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine?
The InChIKey is WKRKTXMYKZZMBW-FNORWQNLSA-N. The full InChI is InChI=1S/C9H20N2O/c1-9(12-4)8-10-6-5-7-11(2)3/h5,7,9-10H,6,8H2,1-4H3/b7-5+.
What are the key properties of (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine?
(E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(2-methoxypropyl)-N,N-dimethylprop-1-ene-1,3-diamine is sourced from PubChem (CID 88690426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).