C10H12Cl3NO5S2 — CID 88690615
O-methyl [(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]sulfanylmethanethioate (PubChem CID 88690615) has the molecular formula C10H12Cl3NO5S2 and a molecular weight of 396.70 g/mol. Its IUPAC name is O-methyl [(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]sulfanylmethanethioate.
| Compound Name | O-methyl [(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 88690615 |
| Molecular Formula | C10H12Cl3NO5S2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | O-methyl [(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl]sulfanylmethanethioate |
| SMILES | COC(=S)S[C@H]1NC(=O)[C@H]1CCOC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO5S2/c1-17-9(20)21-7-5(6(15)14-7)2-3-18-8(16)19-4-10(11,12)13/h5,7H,2-4H2,1H3,(H,14,15)/t5-,7-/m1/s1 |
| InChIKey | CVYNAGBBALXXLS-IYSWYEEDSA-N |
| XLogP | 2.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|