C11H14Cl3NO5S2 — CID 88690644
O-[(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] ethylsulfanylmethanethioate (PubChem CID 88690644) has the molecular formula C11H14Cl3NO5S2 and a molecular weight of 410.73 g/mol. Its IUPAC name is O-[(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] ethylsulfanylmethanethioate.
| Compound Name | O-[(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] ethylsulfanylmethanethioate |
|---|---|
| PubChem CID | 88690644 |
| Molecular Formula | C11H14Cl3NO5S2 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | O-[(2R,3R)-4-oxo-3-[2-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] ethylsulfanylmethanethioate |
| SMILES | CCSC(=S)O[C@H]1NC(=O)[C@@H]1CCOC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3NO5S2/c1-2-22-10(21)20-8-6(7(16)15-8)3-4-18-9(17)19-5-11(12,13)14/h6,8H,2-5H2,1H3,(H,15,16)/t6-,8+/m0/s1 |
| InChIKey | GWPMEFYAEFCKFE-POYBYMJQSA-N |
| XLogP | 3.03 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|