C18H12N2 — CID 88691048
17,20-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5,7,9,11,13,15,18-nonaene (PubChem CID 88691048) has the molecular formula C18H12N2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 17,20-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5,7,9,11,13,15,18-nonaene.
| Compound Name | 17,20-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5,7,9,11,13,15,18-nonaene |
|---|---|
| PubChem CID | 88691048 |
| Molecular Formula | C18H12N2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 17,20-diazapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5,7,9,11,13,15,18-nonaene |
| SMILES | c1ccc2c(c1)cc1cccn3[nH]c4cccc2c4=c13 |
| InChI | InChI=1S/C18H12N2/c1-2-7-14-12(5-1)11-13-6-4-10-20-18(13)17-15(14)8-3-9-16(17)19-20/h1-11,19H |
| InChIKey | XZEFPXXTYNLKNO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |