About chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide
chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide (PubChem CID 88691060) has the molecular formula C8H12ClNO2
and a molecular weight of 189.64 g/mol. Its IUPAC name is chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide.
Molecular Properties
| Compound Name | chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide |
| PubChem CID | 88691060 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide |
| SMILES | C=CCl.O=C(NCO)C1=CCC1 |
| InChI | InChI=1S/C6H9NO2.C2H3Cl/c8-4-7-6(9)5-2-1-3-5;1-2-3/h2,8H,1,3-4H2,(H,7,9);2H,1H2 |
| InChIKey | FTDWFAXERXZSDV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide?
The IUPAC name of chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide (CID 88691060) is chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide.
What is the SMILES notation for chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide?
The canonical SMILES for chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide is C=CCl.O=C(NCO)C1=CCC1.
What is the InChIKey of chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide?
The InChIKey is FTDWFAXERXZSDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.C2H3Cl/c8-4-7-6(9)5-2-1-3-5;1-2-3/h2,8H,1,3-4H2,(H,7,9);2H,1H2.
What are the key properties of chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide?
chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide has a molecular weight of 189.64 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethene;N-(hydroxymethyl)cyclobutene-1-carboxamide is sourced from PubChem (CID 88691060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).