C24H29N2O7S+ — CID 88691149
(2-acetyl-3,4-dimethoxyphenyl)-[3-[(2-oxo-4-propan-2-yl-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]propylidene]-sulfanyloxyazanium (PubChem CID 88691149) has the molecular formula C24H29N2O7S+ and a molecular weight of 489.57 g/mol. Its IUPAC name is (2-acetyl-3,4-dimethoxyphenyl)-[3-[(2-oxo-4-propan-2-yl-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]propylidene]-sulfanyloxyazanium.
| Compound Name | (2-acetyl-3,4-dimethoxyphenyl)-[3-[(2-oxo-4-propan-2-yl-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]propylidene]-sulfanyloxyazanium |
|---|---|
| PubChem CID | 88691149 |
| Molecular Formula | C24H29N2O7S+ |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (2-acetyl-3,4-dimethoxyphenyl)-[3-[(2-oxo-4-propan-2-yl-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]propylidene]-sulfanyloxyazanium |
| SMILES | COc1ccc([N+](=CCCOc2ccc3c(c2)C(C(C)C)OC(=O)N3)OS)c(C(C)=O)c1OC |
| InChI | InChI=1S/C24H28N2O7S/c1-14(2)22-17-13-16(7-8-18(17)25-24(28)32-22)31-12-6-11-26(33-34)19-9-10-20(29-4)23(30-5)21(19)15(3)27/h7-11,13-14,22H,6,12H2,1-5H3,(H-,25,28,34)/p+1 |
| InChIKey | GZFHLLAMXBUTTR-UHFFFAOYSA-O |
| XLogP | 5.13 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|