About N'-tert-butyloxamide;tetraethylazanium
N'-tert-butyloxamide;tetraethylazanium (PubChem CID 88691963) has the molecular formula C14H32N3O2+
and a molecular weight of 274.43 g/mol. Its IUPAC name is N'-tert-butyloxamide;tetraethylazanium.
Molecular Properties
| Compound Name | N'-tert-butyloxamide;tetraethylazanium |
| PubChem CID | 88691963 |
| Molecular Formula | C14H32N3O2+ |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | N'-tert-butyloxamide;tetraethylazanium |
| SMILES | CC(C)(C)NC(=O)C(N)=O.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C6H12N2O2/c1-5-9(6-2,7-3)8-4;1-6(2,3)8-5(10)4(7)9/h5-8H2,1-4H3;1-3H3,(H2,7,9)(H,8,10)/q+1; |
| InChIKey | HQRXNVIHLZAZQL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyloxamide;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyloxamide;tetraethylazanium?
The IUPAC name of N'-tert-butyloxamide;tetraethylazanium (CID 88691963) is N'-tert-butyloxamide;tetraethylazanium.
What is the SMILES notation for N'-tert-butyloxamide;tetraethylazanium?
The canonical SMILES for N'-tert-butyloxamide;tetraethylazanium is CC(C)(C)NC(=O)C(N)=O.CC[N+](CC)(CC)CC.
What is the InChIKey of N'-tert-butyloxamide;tetraethylazanium?
The InChIKey is HQRXNVIHLZAZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C6H12N2O2/c1-5-9(6-2,7-3)8-4;1-6(2,3)8-5(10)4(7)9/h5-8H2,1-4H3;1-3H3,(H2,7,9)(H,8,10)/q+1;.
What are the key properties of N'-tert-butyloxamide;tetraethylazanium?
N'-tert-butyloxamide;tetraethylazanium has a molecular weight of 274.43 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyloxamide;tetraethylazanium is sourced from PubChem (CID 88691963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).