C13H18N2O6S — CID 88692027
S-[[(4S,7R)-4-carboxyoxy-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]methyl] ethanethioate (PubChem CID 88692027) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is S-[[(4S,7R)-4-carboxyoxy-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]methyl] ethanethioate.
| Compound Name | S-[[(4S,7R)-4-carboxyoxy-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 88692027 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | S-[[(4S,7R)-4-carboxyoxy-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H]1CCC(=O)N2CCC[C@H](OC(=O)O)N2C1=O |
| InChI | InChI=1S/C13H18N2O6S/c1-8(16)22-7-9-4-5-10(17)14-6-2-3-11(21-13(19)20)15(14)12(9)18/h9,11H,2-7H2,1H3,(H,19,20)/t9-,11-/m0/s1 |
| InChIKey | BBRFTKUPIHAKMM-ONGXEEELSA-N |
| XLogP | 1.06 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|