About 2-tetradecyliminoacetic acid
2-tetradecyliminoacetic acid (PubChem CID 88692071) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-tetradecyliminoacetic acid.
Molecular Properties
| Compound Name | 2-tetradecyliminoacetic acid |
| PubChem CID | 88692071 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 2-tetradecyliminoacetic acid |
| SMILES | CCCCCCCCCCCCCC/N=C/C(=O)O |
| InChI | InChI=1S/C16H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16(18)19/h15H,2-14H2,1H3,(H,18,19)/b17-15+ |
| InChIKey | QSDQRFDSGYDFGR-BMRADRMJSA-N |
| XLogP | 4.84 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tetradecyliminoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tetradecyliminoacetic acid?
The IUPAC name of 2-tetradecyliminoacetic acid (CID 88692071) is 2-tetradecyliminoacetic acid.
What is the SMILES notation for 2-tetradecyliminoacetic acid?
The canonical SMILES for 2-tetradecyliminoacetic acid is CCCCCCCCCCCCCC/N=C/C(=O)O.
What is the InChIKey of 2-tetradecyliminoacetic acid?
The InChIKey is QSDQRFDSGYDFGR-BMRADRMJSA-N. The full InChI is InChI=1S/C16H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16(18)19/h15H,2-14H2,1H3,(H,18,19)/b17-15+.
What are the key properties of 2-tetradecyliminoacetic acid?
2-tetradecyliminoacetic acid has a molecular weight of 269.43 g/mol, XLogP of 4.84, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tetradecyliminoacetic acid is sourced from PubChem (CID 88692071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).