About 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane
2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane (PubChem CID 88692183) has the molecular formula C8H11Br
and a molecular weight of 187.08 g/mol. Its IUPAC name is 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane |
| PubChem CID | 88692183 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane |
| SMILES | CC1(C)CC1C=C=CBr |
| InChI | InChI=1S/C8H11Br/c1-8(2)6-7(8)4-3-5-9/h4-5,7H,6H2,1-2H3 |
| InChIKey | QROSTJGWNVXZIL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane?
The IUPAC name of 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane (CID 88692183) is 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane?
The canonical SMILES for 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane is CC1(C)CC1C=C=CBr.
What is the InChIKey of 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane?
The InChIKey is QROSTJGWNVXZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Br/c1-8(2)6-7(8)4-3-5-9/h4-5,7H,6H2,1-2H3.
What are the key properties of 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane?
2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane has a molecular weight of 187.08 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromopropa-1,2-dienyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 88692183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).