About 6,6-difluoro-2-methylidenehexane-1,5-diamine
6,6-difluoro-2-methylidenehexane-1,5-diamine (PubChem CID 88692334) has the molecular formula C7H14F2N2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 6,6-difluoro-2-methylidenehexane-1,5-diamine.
Molecular Properties
| Compound Name | 6,6-difluoro-2-methylidenehexane-1,5-diamine |
| PubChem CID | 88692334 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6,6-difluoro-2-methylidenehexane-1,5-diamine |
| SMILES | C=C(CN)CCC(N)C(F)F |
| InChI | InChI=1S/C7H14F2N2/c1-5(4-10)2-3-6(11)7(8)9/h6-7H,1-4,10-11H2 |
| InChIKey | QRTIYMTUNHLRIX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-difluoro-2-methylidenehexane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-difluoro-2-methylidenehexane-1,5-diamine?
The IUPAC name of 6,6-difluoro-2-methylidenehexane-1,5-diamine (CID 88692334) is 6,6-difluoro-2-methylidenehexane-1,5-diamine.
What is the SMILES notation for 6,6-difluoro-2-methylidenehexane-1,5-diamine?
The canonical SMILES for 6,6-difluoro-2-methylidenehexane-1,5-diamine is C=C(CN)CCC(N)C(F)F.
What is the InChIKey of 6,6-difluoro-2-methylidenehexane-1,5-diamine?
The InChIKey is QRTIYMTUNHLRIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2N2/c1-5(4-10)2-3-6(11)7(8)9/h6-7H,1-4,10-11H2.
What are the key properties of 6,6-difluoro-2-methylidenehexane-1,5-diamine?
6,6-difluoro-2-methylidenehexane-1,5-diamine has a molecular weight of 164.20 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-difluoro-2-methylidenehexane-1,5-diamine is sourced from PubChem (CID 88692334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).