C7H14F2N2 — CID 88692381
1,6-difluoro-2-methylidenehexane-1,5-diamine (PubChem CID 88692381) has the molecular formula C7H14F2N2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1,6-difluoro-2-methylidenehexane-1,5-diamine.
| Compound Name | 1,6-difluoro-2-methylidenehexane-1,5-diamine |
|---|---|
| PubChem CID | 88692381 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1,6-difluoro-2-methylidenehexane-1,5-diamine |
| SMILES | C=C(CCC(N)CF)C(N)F |
| InChI | InChI=1S/C7H14F2N2/c1-5(7(9)11)2-3-6(10)4-8/h6-7H,1-4,10-11H2 |
| InChIKey | BDTOMIAMBUJVEW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|