About 1,5-difluoro-2-methylidenepentane-1,4-diamine
1,5-difluoro-2-methylidenepentane-1,4-diamine (PubChem CID 88692730) has the molecular formula C6H12F2N2
and a molecular weight of 150.17 g/mol. Its IUPAC name is 1,5-difluoro-2-methylidenepentane-1,4-diamine.
Molecular Properties
| Compound Name | 1,5-difluoro-2-methylidenepentane-1,4-diamine |
| PubChem CID | 88692730 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1,5-difluoro-2-methylidenepentane-1,4-diamine |
| SMILES | C=C(CC(N)CF)C(N)F |
| InChI | InChI=1S/C6H12F2N2/c1-4(6(8)10)2-5(9)3-7/h5-6H,1-3,9-10H2 |
| InChIKey | NWNYRYFCGHXLDU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,5-difluoro-2-methylidenepentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-difluoro-2-methylidenepentane-1,4-diamine?
The IUPAC name of 1,5-difluoro-2-methylidenepentane-1,4-diamine (CID 88692730) is 1,5-difluoro-2-methylidenepentane-1,4-diamine.
What is the SMILES notation for 1,5-difluoro-2-methylidenepentane-1,4-diamine?
The canonical SMILES for 1,5-difluoro-2-methylidenepentane-1,4-diamine is C=C(CC(N)CF)C(N)F.
What is the InChIKey of 1,5-difluoro-2-methylidenepentane-1,4-diamine?
The InChIKey is NWNYRYFCGHXLDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2/c1-4(6(8)10)2-5(9)3-7/h5-6H,1-3,9-10H2.
What are the key properties of 1,5-difluoro-2-methylidenepentane-1,4-diamine?
1,5-difluoro-2-methylidenepentane-1,4-diamine has a molecular weight of 150.17 g/mol, XLogP of 0.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-difluoro-2-methylidenepentane-1,4-diamine is sourced from PubChem (CID 88692730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).