About 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride
2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride (PubChem CID 88692772) has the molecular formula C12H28ClOPS2
and a molecular weight of 318.92 g/mol. Its IUPAC name is 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride.
Molecular Properties
| Compound Name | 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride |
| PubChem CID | 88692772 |
| Molecular Formula | C12H28ClOPS2 |
| Molecular Weight | 318.92 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride |
| SMILES | CCCC(C)CSP(O)(=S)CC(C)(C)CC.Cl |
| InChI | InChI=1S/C12H27OPS2.ClH/c1-6-8-11(3)9-16-14(13,15)10-12(4,5)7-2;/h11H,6-10H2,1-5H3,(H,13,15);1H |
| InChIKey | XCAMJMFVDRMATC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.92 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride?
The IUPAC name of 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride (CID 88692772) is 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride.
What is the SMILES notation for 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride?
The canonical SMILES for 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride is CCCC(C)CSP(O)(=S)CC(C)(C)CC.Cl.
What is the InChIKey of 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride?
The InChIKey is XCAMJMFVDRMATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27OPS2.ClH/c1-6-8-11(3)9-16-14(13,15)10-12(4,5)7-2;/h11H,6-10H2,1-5H3,(H,13,15);1H.
What are the key properties of 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride?
2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride has a molecular weight of 318.92 g/mol, XLogP of 5.32, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutyl-hydroxy-(2-methylpentylsulfanyl)-sulfanylidene-λ5-phosphane;hydrochloride is sourced from PubChem (CID 88692772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).