C22H23Cl2N2O4S+ — CID 88692906
(2-acetyl-3,4-dichlorophenyl)-[4-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)oxy]butylidene]-sulfanyloxyazanium (PubChem CID 88692906) has the molecular formula C22H23Cl2N2O4S+ and a molecular weight of 482.41 g/mol. Its IUPAC name is (2-acetyl-3,4-dichlorophenyl)-[4-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)oxy]butylidene]-sulfanyloxyazanium.
| Compound Name | (2-acetyl-3,4-dichlorophenyl)-[4-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)oxy]butylidene]-sulfanyloxyazanium |
|---|---|
| PubChem CID | 88692906 |
| Molecular Formula | C22H23Cl2N2O4S+ |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | (2-acetyl-3,4-dichlorophenyl)-[4-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)oxy]butylidene]-sulfanyloxyazanium |
| SMILES | CC(=O)c1c([N+](=CCCCOc2ccc3c(c2)C(C)(C)C(=O)N3)OS)ccc(Cl)c1Cl |
| InChI | InChI=1S/C22H22Cl2N2O4S/c1-13(27)19-18(9-7-16(23)20(19)24)26(30-31)10-4-5-11-29-14-6-8-17-15(12-14)22(2,3)21(28)25-17/h6-10,12H,4-5,11H2,1-3H3,(H-,25,28,31)/p+1 |
| InChIKey | ZMPOCEPINBABBT-UHFFFAOYSA-O |
| XLogP | 5.78 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|