About 1,1-difluoro-3-methylideneoctane-2,6-diamine
1,1-difluoro-3-methylideneoctane-2,6-diamine (PubChem CID 88692921) has the molecular formula C9H18F2N2
and a molecular weight of 192.25 g/mol. Its IUPAC name is 1,1-difluoro-3-methylideneoctane-2,6-diamine.
Molecular Properties
| Compound Name | 1,1-difluoro-3-methylideneoctane-2,6-diamine |
| PubChem CID | 88692921 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1,1-difluoro-3-methylideneoctane-2,6-diamine |
| SMILES | C=C(CCC(N)CC)C(N)C(F)F |
| InChI | InChI=1S/C9H18F2N2/c1-3-7(12)5-4-6(2)8(13)9(10)11/h7-9H,2-5,12-13H2,1H3 |
| InChIKey | WMBGAGPIIIQQMV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-3-methylideneoctane-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-3-methylideneoctane-2,6-diamine?
The IUPAC name of 1,1-difluoro-3-methylideneoctane-2,6-diamine (CID 88692921) is 1,1-difluoro-3-methylideneoctane-2,6-diamine.
What is the SMILES notation for 1,1-difluoro-3-methylideneoctane-2,6-diamine?
The canonical SMILES for 1,1-difluoro-3-methylideneoctane-2,6-diamine is C=C(CCC(N)CC)C(N)C(F)F.
What is the InChIKey of 1,1-difluoro-3-methylideneoctane-2,6-diamine?
The InChIKey is WMBGAGPIIIQQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2/c1-3-7(12)5-4-6(2)8(13)9(10)11/h7-9H,2-5,12-13H2,1H3.
What are the key properties of 1,1-difluoro-3-methylideneoctane-2,6-diamine?
1,1-difluoro-3-methylideneoctane-2,6-diamine has a molecular weight of 192.25 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-3-methylideneoctane-2,6-diamine is sourced from PubChem (CID 88692921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).