About disulfanylmethyl N-aminocarbamate
disulfanylmethyl N-aminocarbamate (PubChem CID 88693012) has the molecular formula C2H6N2O2S2
and a molecular weight of 154.22 g/mol. Its IUPAC name is disulfanylmethyl N-aminocarbamate.
Molecular Properties
| Compound Name | disulfanylmethyl N-aminocarbamate |
| PubChem CID | 88693012 |
| Molecular Formula | C2H6N2O2S2 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | disulfanylmethyl N-aminocarbamate |
| SMILES | NNC(=O)OCSS |
| InChI | InChI=1S/C2H6N2O2S2/c3-4-2(5)6-1-8-7/h7H,1,3H2,(H,4,5) |
| InChIKey | ATRIPNUKTOXTRL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disulfanylmethyl N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disulfanylmethyl N-aminocarbamate?
The IUPAC name of disulfanylmethyl N-aminocarbamate (CID 88693012) is disulfanylmethyl N-aminocarbamate.
What is the SMILES notation for disulfanylmethyl N-aminocarbamate?
The canonical SMILES for disulfanylmethyl N-aminocarbamate is NNC(=O)OCSS.
What is the InChIKey of disulfanylmethyl N-aminocarbamate?
The InChIKey is ATRIPNUKTOXTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2S2/c3-4-2(5)6-1-8-7/h7H,1,3H2,(H,4,5).
What are the key properties of disulfanylmethyl N-aminocarbamate?
disulfanylmethyl N-aminocarbamate has a molecular weight of 154.22 g/mol, XLogP of 0.12, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disulfanylmethyl N-aminocarbamate is sourced from PubChem (CID 88693012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).