C22H35NO4 — CID 88693197
methyl 3-[(E)-[(3aR,6aR)-6-[(Z)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-ylidene]amino]oxypropanoate (PubChem CID 88693197) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is methyl 3-[(E)-[(3aR,6aR)-6-[(Z)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-ylidene]amino]oxypropanoate.
| Compound Name | methyl 3-[(E)-[(3aR,6aR)-6-[(Z)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-ylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 88693197 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | methyl 3-[(E)-[(3aR,6aR)-6-[(Z)-3-hydroxy-4,4-dimethyloct-1-enyl]-3,3a,4,6a-tetrahydro-1H-pentalen-2-ylidene]amino]oxypropanoate |
| SMILES | CCCCC(C)(C)C(O)/C=C\C1=CC[C@@H]2C/C(=N\OCCC(=O)OC)C[C@@H]12 |
| InChI | InChI=1S/C22H35NO4/c1-5-6-12-22(2,3)20(24)10-9-16-7-8-17-14-18(15-19(16)17)23-27-13-11-21(25)26-4/h7,9-10,17,19-20,24H,5-6,8,11-15H2,1-4H3/b10-9-,23-18+/t17-,19+,20?/m1/s1 |
| InChIKey | HITPCYOTBCGCAC-BKQCYWBKSA-N |
| XLogP | 4.41 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|