C20H29NO4 — CID 88693422
4-methyloct-1-en-6-yn-3-yl 3-[[(3aS,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate (PubChem CID 88693422) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-methyloct-1-en-6-yn-3-yl 3-[[(3aS,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate.
| Compound Name | 4-methyloct-1-en-6-yn-3-yl 3-[[(3aS,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 88693422 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-methyloct-1-en-6-yn-3-yl 3-[[(3aS,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]amino]oxypropanoate |
| SMILES | C=CC(OC(=O)CCON=C1C[C@H]2CC(O)C[C@@H]2C1)C(C)CC#CC |
| InChI | InChI=1S/C20H29NO4/c1-4-6-7-14(3)19(5-2)25-20(23)8-9-24-21-17-10-15-12-18(22)13-16(15)11-17/h5,14-16,18-19,22H,2,7-13H2,1,3H3/b21-17-/t14?,15-,16-,18?,19?/m0/s1 |
| InChIKey | OXOFRNYCHZIXGV-PJDQPLQMSA-N |
| XLogP | 3.08 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|