C17H24O4S — CID 88693962
2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl 2-sulfanylacetate (PubChem CID 88693962) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is 2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl 2-sulfanylacetate.
| Compound Name | 2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 88693962 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl 2-sulfanylacetate |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOC(=O)CS)O2 |
| InChI | InChI=1S/C17H24O4S/c1-10-11(2)16-13(12(3)15(10)19)5-6-17(4,21-16)7-8-20-14(18)9-22/h19,22H,5-9H2,1-4H3 |
| InChIKey | ARKQFGWQEMYMPK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|