C27H44O12 — CID 88693986
(Z,12R)-2,3,3-triacetyloxy-2-(2,3-dihydroxypropanoyl)-12-hydroxyoctadec-9-enoic acid (PubChem CID 88693986) has the molecular formula C27H44O12 and a molecular weight of 560.64 g/mol. Its IUPAC name is (Z,12R)-2,3,3-triacetyloxy-2-(2,3-dihydroxypropanoyl)-12-hydroxyoctadec-9-enoic acid.
| Compound Name | (Z,12R)-2,3,3-triacetyloxy-2-(2,3-dihydroxypropanoyl)-12-hydroxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 88693986 |
| Molecular Formula | C27H44O12 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | (Z,12R)-2,3,3-triacetyloxy-2-(2,3-dihydroxypropanoyl)-12-hydroxyoctadec-9-enoic acid |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCC(OC(C)=O)(OC(C)=O)C(OC(C)=O)(C(=O)O)C(=O)C(O)CO |
| InChI | InChI=1S/C27H44O12/c1-5-6-7-12-15-22(32)16-13-10-8-9-11-14-17-26(37-19(2)29,38-20(3)30)27(25(35)36,39-21(4)31)24(34)23(33)18-28/h10,13,22-23,28,32-33H,5-9,11-12,14-18H2,1-4H3,(H,35,36)/b13-10-/t22-,23?,27?/m1/s1 |
| InChIKey | RFLIFWSNFNCASF-UPGQZALZSA-N |
| XLogP | 2.35 |
| TPSA | 193.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|