About butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate
butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate (PubChem CID 88694026) has the molecular formula C15H29NS5
and a molecular weight of 383.74 g/mol. Its IUPAC name is butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate |
| PubChem CID | 88694026 |
| Molecular Formula | C15H29NS5 |
| Molecular Weight | 383.74 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate |
| SMILES | C=CCSC(=S)SCCCC.CCSC(=S)N(CC)CC |
| InChI | InChI=1S/C8H14S3.C7H15NS2/c1-3-5-7-11-8(9)10-6-4-2;1-4-8(5-2)7(9)10-6-3/h4H,2-3,5-7H2,1H3;4-6H2,1-3H3 |
| InChIKey | CKGBKNLXVXYAFL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.74 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate?
The IUPAC name of butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate (CID 88694026) is butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate.
What is the SMILES notation for butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate?
The canonical SMILES for butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate is C=CCSC(=S)SCCCC.CCSC(=S)N(CC)CC.
What is the InChIKey of butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate?
The InChIKey is CKGBKNLXVXYAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S3.C7H15NS2/c1-3-5-7-11-8(9)10-6-4-2;1-4-8(5-2)7(9)10-6-3/h4H,2-3,5-7H2,1H3;4-6H2,1-3H3.
What are the key properties of butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate?
butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate has a molecular weight of 383.74 g/mol, XLogP of 6.09, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfanyl(prop-2-enylsulfanyl)methanethione;ethyl N,N-diethylcarbamodithioate is sourced from PubChem (CID 88694026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).