About dichlorocopper;N,N-diethylethanamine
dichlorocopper;N,N-diethylethanamine (PubChem CID 88694959) has the molecular formula C6H15Cl2CuN
and a molecular weight of 235.64 g/mol. Its IUPAC name is dichlorocopper;N,N-diethylethanamine.
Molecular Properties
| Compound Name | dichlorocopper;N,N-diethylethanamine |
| PubChem CID | 88694959 |
| Molecular Formula | C6H15Cl2CuN |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | dichlorocopper;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Cl[Cu]Cl |
| InChI | InChI=1S/C6H15N.2ClH.Cu/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | LKQGGXRMYFIIQH-UHFFFAOYSA-L |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichlorocopper;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;N,N-diethylethanamine?
The IUPAC name of dichlorocopper;N,N-diethylethanamine (CID 88694959) is dichlorocopper;N,N-diethylethanamine.
What is the SMILES notation for dichlorocopper;N,N-diethylethanamine?
The canonical SMILES for dichlorocopper;N,N-diethylethanamine is CCN(CC)CC.Cl[Cu]Cl.
What is the InChIKey of dichlorocopper;N,N-diethylethanamine?
The InChIKey is LKQGGXRMYFIIQH-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H15N.2ClH.Cu/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocopper;N,N-diethylethanamine?
dichlorocopper;N,N-diethylethanamine has a molecular weight of 235.64 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;N,N-diethylethanamine is sourced from PubChem (CID 88694959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).