About 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid
2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid (PubChem CID 88695385) has the molecular formula C10H11NO5
and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid |
| PubChem CID | 88695385 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid |
| SMILES | NC(C(=O)O)C(O)c1ccc2c(c1)OOC2 |
| InChI | InChI=1S/C10H11NO5/c11-8(10(13)14)9(12)5-1-2-6-4-15-16-7(6)3-5/h1-3,8-9,12H,4,11H2,(H,13,14) |
| InChIKey | KZSIGJIAZBLSBR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid?
The IUPAC name of 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid (CID 88695385) is 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid.
What is the SMILES notation for 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid?
The canonical SMILES for 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid is NC(C(=O)O)C(O)c1ccc2c(c1)OOC2.
What is the InChIKey of 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid?
The InChIKey is KZSIGJIAZBLSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5/c11-8(10(13)14)9(12)5-1-2-6-4-15-16-7(6)3-5/h1-3,8-9,12H,4,11H2,(H,13,14).
What are the key properties of 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid?
2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid has a molecular weight of 225.20 g/mol, XLogP of -0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3H-1,2-benzodioxol-6-yl)-3-hydroxypropanoic acid is sourced from PubChem (CID 88695385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).