C8H10N2O4S — CID 88695554
2-methylprop-2-enoic acid;2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 88695554) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 2-methylprop-2-enoic acid;2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 88695554 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-methylprop-2-enoic acid;2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=C(C)C(=O)O.O=C1CC(=O)NC(=S)N1 |
| InChI | InChI=1S/C4H4N2O2S.C4H6O2/c7-2-1-3(8)6-4(9)5-2;1-3(2)4(5)6/h1H2,(H2,5,6,7,8,9);1H2,2H3,(H,5,6) |
| InChIKey | QWKFFORNXIOZIR-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|