C16H20F3NO4 — CID 88695658
2,2,2-trifluoro-N-[(2R,3R,4S,6S)-6-methoxy-2-methyl-3-phenylmethoxyoxan-4-yl]acetamide (PubChem CID 88695658) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,3R,4S,6S)-6-methoxy-2-methyl-3-phenylmethoxyoxan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,3R,4S,6S)-6-methoxy-2-methyl-3-phenylmethoxyoxan-4-yl]acetamide |
|---|---|
| PubChem CID | 88695658 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,3R,4S,6S)-6-methoxy-2-methyl-3-phenylmethoxyoxan-4-yl]acetamide |
| SMILES | CO[C@@H]1C[C@H](NC(=O)C(F)(F)F)[C@@H](OCc2ccccc2)[C@@H](C)O1 |
| InChI | InChI=1S/C16H20F3NO4/c1-10-14(23-9-11-6-4-3-5-7-11)12(8-13(22-2)24-10)20-15(21)16(17,18)19/h3-7,10,12-14H,8-9H2,1-2H3,(H,20,21)/t10-,12+,13+,14+/m1/s1 |
| InChIKey | NSGFIYWIBOZCNP-SAXRGWBVSA-N |
| XLogP | 2.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |