C18H14Cl6N4O2 — CID 88695715
2-(pyridin-3-ylmethylamino)ethanol;2,3,5-trichloro-6-[(3,5,6-trichloro-2-pyridinyl)oxy]pyridine (PubChem CID 88695715) has the molecular formula C18H14Cl6N4O2 and a molecular weight of 531.05 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylamino)ethanol;2,3,5-trichloro-6-[(3,5,6-trichloro-2-pyridinyl)oxy]pyridine.
| Compound Name | 2-(pyridin-3-ylmethylamino)ethanol;2,3,5-trichloro-6-[(3,5,6-trichloro-2-pyridinyl)oxy]pyridine |
|---|---|
| PubChem CID | 88695715 |
| Molecular Formula | C18H14Cl6N4O2 |
| Molecular Weight | 531.05 g/mol |
| Exact Mass | 527.92 |
| IUPAC Name | 2-(pyridin-3-ylmethylamino)ethanol;2,3,5-trichloro-6-[(3,5,6-trichloro-2-pyridinyl)oxy]pyridine |
| SMILES | Clc1cc(Cl)c(Oc2nc(Cl)c(Cl)cc2Cl)nc1Cl.OCCNCc1cccnc1 |
| InChI | InChI=1S/C10H2Cl6N2O.C8H12N2O/c11-3-1-5(13)9(17-7(3)15)19-10-6(14)2-4(12)8(16)18-10;11-5-4-10-7-8-2-1-3-9-6-8/h1-2H;1-3,6,10-11H,4-5,7H2 |
| InChIKey | KMHZYMSIXCNHKK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.05 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|