About [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid)
[5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) (PubChem CID 88696106) has the molecular formula C8H18N2O9
and a molecular weight of 286.24 g/mol. Its IUPAC name is [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid).
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) |
| PubChem CID | 88696106 |
| Molecular Formula | C8H18N2O9 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) |
| SMILES | CC1C(CO)OC(CO)C1C.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C8H16O3.2HNO3/c1-5-6(2)8(4-10)11-7(5)3-9;2*2-1(3)4/h5-10H,3-4H2,1-2H3;2*(H,2,3,4) |
| InChIKey | PKOUBIYQVHPLIE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid)?
The IUPAC name of [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) (CID 88696106) is [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid).
What is the SMILES notation for [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid)?
The canonical SMILES for [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) is CC1C(CO)OC(CO)C1C.O=[N+]([O-])O.O=[N+]([O-])O.
What is the InChIKey of [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid)?
The InChIKey is PKOUBIYQVHPLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3.2HNO3/c1-5-6(2)8(4-10)11-7(5)3-9;2*2-1(3)4/h5-10H,3-4H2,1-2H3;2*(H,2,3,4).
What are the key properties of [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid)?
[5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) has a molecular weight of 286.24 g/mol, XLogP of -0.68, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]methanol;bis(nitric acid) is sourced from PubChem (CID 88696106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).