About (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine
(E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine (PubChem CID 88697788) has the molecular formula C8H16F2N2
and a molecular weight of 178.23 g/mol. Its IUPAC name is (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine.
Molecular Properties
| Compound Name | (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine |
| PubChem CID | 88697788 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine |
| SMILES | CC/C(=C\CN)CC(N)C(F)F |
| InChI | InChI=1S/C8H16F2N2/c1-2-6(3-4-11)5-7(12)8(9)10/h3,7-8H,2,4-5,11-12H2,1H3/b6-3+ |
| InChIKey | LIQZJSAPTIMJFK-ZZXKWVIFSA-N |
| XLogP | 1.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine?
The IUPAC name of (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine (CID 88697788) is (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine.
What is the SMILES notation for (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine?
The canonical SMILES for (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine is CC/C(=C\CN)CC(N)C(F)F.
What is the InChIKey of (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine?
The InChIKey is LIQZJSAPTIMJFK-ZZXKWVIFSA-N. The full InChI is InChI=1S/C8H16F2N2/c1-2-6(3-4-11)5-7(12)8(9)10/h3,7-8H,2,4-5,11-12H2,1H3/b6-3+.
What are the key properties of (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine?
(E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine has a molecular weight of 178.23 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethyl-6,6-difluorohex-2-ene-1,5-diamine is sourced from PubChem (CID 88697788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).