C7H5F3N2O4 — CID 88698265
1,5,6-trifluoro-2-methyl-5,6-dinitrocyclohexa-1,3-diene (PubChem CID 88698265) has the molecular formula C7H5F3N2O4 and a molecular weight of 238.12 g/mol. Its IUPAC name is 1,5,6-trifluoro-2-methyl-5,6-dinitrocyclohexa-1,3-diene.
| Compound Name | 1,5,6-trifluoro-2-methyl-5,6-dinitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88698265 |
| Molecular Formula | C7H5F3N2O4 |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 1,5,6-trifluoro-2-methyl-5,6-dinitrocyclohexa-1,3-diene |
| SMILES | CC1=C(F)C(F)([N+](=O)[O-])C(F)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C7H5F3N2O4/c1-4-2-3-6(9,11(13)14)7(10,5(4)8)12(15)16/h2-3H,1H3 |
| InChIKey | WWSBEWISVFXJGO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|