About 2-diphenylarsanylethyl-methyl-diphenylphosphanium
2-diphenylarsanylethyl-methyl-diphenylphosphanium (PubChem CID 88698614) has the molecular formula C27H27AsP+
and a molecular weight of 457.41 g/mol. Its IUPAC name is 2-diphenylarsanylethyl-methyl-diphenylphosphanium.
Molecular Properties
| Compound Name | 2-diphenylarsanylethyl-methyl-diphenylphosphanium |
| PubChem CID | 88698614 |
| Molecular Formula | C27H27AsP+ |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-diphenylarsanylethyl-methyl-diphenylphosphanium |
| SMILES | C[P+](CC[As](c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27AsP/c1-29(26-18-10-4-11-19-26,27-20-12-5-13-21-27)23-22-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h2-21H,22-23H2,1H3/q+1 |
| InChIKey | GNXGOIDRPFUDIX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylarsanylethyl-methyl-diphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylarsanylethyl-methyl-diphenylphosphanium?
The IUPAC name of 2-diphenylarsanylethyl-methyl-diphenylphosphanium (CID 88698614) is 2-diphenylarsanylethyl-methyl-diphenylphosphanium.
What is the SMILES notation for 2-diphenylarsanylethyl-methyl-diphenylphosphanium?
The canonical SMILES for 2-diphenylarsanylethyl-methyl-diphenylphosphanium is C[P+](CC[As](c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-diphenylarsanylethyl-methyl-diphenylphosphanium?
The InChIKey is GNXGOIDRPFUDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27AsP/c1-29(26-18-10-4-11-19-26,27-20-12-5-13-21-27)23-22-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h2-21H,22-23H2,1H3/q+1.
What are the key properties of 2-diphenylarsanylethyl-methyl-diphenylphosphanium?
2-diphenylarsanylethyl-methyl-diphenylphosphanium has a molecular weight of 457.41 g/mol, XLogP of 4.59, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylarsanylethyl-methyl-diphenylphosphanium is sourced from PubChem (CID 88698614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).