About ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate
ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate (PubChem CID 88698726) has the molecular formula C9H16F2N2O2
and a molecular weight of 222.23 g/mol. Its IUPAC name is ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate |
| PubChem CID | 88698726 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate |
| SMILES | CCOC(=O)C(N)(/C=C(\C)CN)C(F)F |
| InChI | InChI=1S/C9H16F2N2O2/c1-3-15-8(14)9(13,7(10)11)4-6(2)5-12/h4,7H,3,5,12-13H2,1-2H3/b6-4+ |
| InChIKey | UNDQZKIAFHAORY-GQCTYLIASA-N |
| XLogP | 0.42 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate?
The IUPAC name of ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate (CID 88698726) is ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate.
What is the SMILES notation for ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate?
The canonical SMILES for ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate is CCOC(=O)C(N)(/C=C(\C)CN)C(F)F.
What is the InChIKey of ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate?
The InChIKey is UNDQZKIAFHAORY-GQCTYLIASA-N. The full InChI is InChI=1S/C9H16F2N2O2/c1-3-15-8(14)9(13,7(10)11)4-6(2)5-12/h4,7H,3,5,12-13H2,1-2H3/b6-4+.
What are the key properties of ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate?
ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate has a molecular weight of 222.23 g/mol, XLogP of 0.42, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2,5-diamino-2-(difluoromethyl)-4-methylpent-3-enoate is sourced from PubChem (CID 88698726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).