C20H24NiO2 — CID 88698888
nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 88698888) has the molecular formula C20H24NiO2 and a molecular weight of 355.10 g/mol. Its IUPAC name is nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 88698888 |
| Molecular Formula | C20H24NiO2 |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.CC1=C(C)C(=O)C(C)=C(C)C1=O.[Ni] |
| InChI | InChI=1S/C10H12O2.C10H12.Ni/c1-5-6(2)10(12)8(4)7(3)9(5)11;1-2-9-7-4-5-8(6-7)10(9)3-1;/h1-4H3;1-2,4-5,7-10H,3,6H2; |
| InChIKey | ZXPHZTBCQXUWNO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|