C10H11F3KO5PS2 — CID 88698911
potassium ethoxy-oxido-sulfanylidene-[4-(2,2,2-trifluoroethylsulfonyl)phenoxy]-λ5-phosphane (PubChem CID 88698911) has the molecular formula C10H11F3KO5PS2 and a molecular weight of 402.39 g/mol. Its IUPAC name is potassium ethoxy-oxido-sulfanylidene-[4-(2,2,2-trifluoroethylsulfonyl)phenoxy]-λ5-phosphane.
| Compound Name | potassium ethoxy-oxido-sulfanylidene-[4-(2,2,2-trifluoroethylsulfonyl)phenoxy]-λ5-phosphane |
|---|---|
| PubChem CID | 88698911 |
| Molecular Formula | C10H11F3KO5PS2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | potassium ethoxy-oxido-sulfanylidene-[4-(2,2,2-trifluoroethylsulfonyl)phenoxy]-λ5-phosphane |
| SMILES | CCOP([O-])(=S)Oc1ccc(S(=O)(=O)CC(F)(F)F)cc1.[K+] |
| InChI | InChI=1S/C10H12F3O5PS2.K/c1-2-17-19(14,20)18-8-3-5-9(6-4-8)21(15,16)7-10(11,12)13;/h3-6H,2,7H2,1H3,(H,14,20);/q;+1/p-1 |
| InChIKey | VVKVUKBNYNLDDP-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|