C18H24NiO2 — CID 88698930
(1Z,5Z)-cycloocta-1,5-diene;nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 88698930) has the molecular formula C18H24NiO2 and a molecular weight of 331.08 g/mol. Its IUPAC name is (1Z,5Z)-cycloocta-1,5-diene;nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | (1Z,5Z)-cycloocta-1,5-diene;nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 88698930 |
| Molecular Formula | C18H24NiO2 |
| Molecular Weight | 331.08 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (1Z,5Z)-cycloocta-1,5-diene;nickel;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C1=C\CC/C=C\CC/1.CC1=C(C)C(=O)C(C)=C(C)C1=O.[Ni] |
| InChI | InChI=1S/C10H12O2.C8H12.Ni/c1-5-6(2)10(12)8(4)7(3)9(5)11;1-2-4-6-8-7-5-3-1;/h1-4H3;1-2,7-8H,3-6H2;/b;2-1-,8-7-; |
| InChIKey | KMQIRZWEKVPSAZ-GHDUESPLSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.08 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|