C27H48O4S — CID 88699237
3-hydroxy-6-methyl-2-(3,7,11,15-tetramethylhexadecyl)benzenesulfonic acid (PubChem CID 88699237) has the molecular formula C27H48O4S and a molecular weight of 468.74 g/mol. Its IUPAC name is 3-hydroxy-6-methyl-2-(3,7,11,15-tetramethylhexadecyl)benzenesulfonic acid.
| Compound Name | 3-hydroxy-6-methyl-2-(3,7,11,15-tetramethylhexadecyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88699237 |
| Molecular Formula | C27H48O4S |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | 3-hydroxy-6-methyl-2-(3,7,11,15-tetramethylhexadecyl)benzenesulfonic acid |
| SMILES | Cc1ccc(O)c(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)c1S(=O)(=O)O |
| InChI | InChI=1S/C27H48O4S/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-15-23(5)16-18-25-26(28)19-17-24(6)27(25)32(29,30)31/h17,19-23,28H,7-16,18H2,1-6H3,(H,29,30,31) |
| InChIKey | BFJNDGRDKYGTIC-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|