C16H21NO8S — CID 88699295
(2S,5R)-3,3-dimethyl-7-oxo-6-(2-oxopropylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;2-(dioxiran-3-yl)-2-methylpropanoic acid (PubChem CID 88699295) has the molecular formula C16H21NO8S and a molecular weight of 387.41 g/mol. Its IUPAC name is (2S,5R)-3,3-dimethyl-7-oxo-6-(2-oxopropylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;2-(dioxiran-3-yl)-2-methylpropanoic acid.
| Compound Name | (2S,5R)-3,3-dimethyl-7-oxo-6-(2-oxopropylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;2-(dioxiran-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 88699295 |
| Molecular Formula | C16H21NO8S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (2S,5R)-3,3-dimethyl-7-oxo-6-(2-oxopropylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;2-(dioxiran-3-yl)-2-methylpropanoic acid |
| SMILES | CC(=O)C=C1C(=O)N2[C@@H]1SC(C)(C)[C@@H]2C(=O)O.CC(C)(C(=O)O)C1OO1 |
| InChI | InChI=1S/C11H13NO4S.C5H8O4/c1-5(13)4-6-8(14)12-7(10(15)16)11(2,3)17-9(6)12;1-5(2,3(6)7)4-8-9-4/h4,7,9H,1-3H3,(H,15,16);4H,1-2H3,(H,6,7)/t7-,9+;/m0./s1 |
| InChIKey | DJRDGBZASUDSLE-DKXTVVGFSA-N |
| XLogP | 1.03 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|