C11H14N2O5S2 — CID 88699529
(5R,6S)-6-(1-hydroxyethyl)-3-(2-methoxyiminoethylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 88699529) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (5R,6S)-6-(1-hydroxyethyl)-3-(2-methoxyiminoethylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-(1-hydroxyethyl)-3-(2-methoxyiminoethylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88699529 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (5R,6S)-6-(1-hydroxyethyl)-3-(2-methoxyiminoethylsulfanyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CON=CCSC1=C(C(=O)O)N2C(=O)[C@H](C(C)O)[C@H]2S1 |
| InChI | InChI=1S/C11H14N2O5S2/c1-5(14)6-8(15)13-7(10(16)17)11(20-9(6)13)19-4-3-12-18-2/h3,5-6,9,14H,4H2,1-2H3,(H,16,17)/t5?,6-,9+/m0/s1 |
| InChIKey | MMADSSPYBRXLHM-QFBIRUJASA-N |
| XLogP | 0.52 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|