About 1-bromo-2-prop-2-enylbenzene;triphenylphosphane
1-bromo-2-prop-2-enylbenzene;triphenylphosphane (PubChem CID 88699732) has the molecular formula C27H24BrP
and a molecular weight of 459.37 g/mol. Its IUPAC name is 1-bromo-2-prop-2-enylbenzene;triphenylphosphane.
Molecular Properties
| Compound Name | 1-bromo-2-prop-2-enylbenzene;triphenylphosphane |
| PubChem CID | 88699732 |
| Molecular Formula | C27H24BrP |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 1-bromo-2-prop-2-enylbenzene;triphenylphosphane |
| SMILES | C=CCc1ccccc1Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C9H9Br/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-5-8-6-3-4-7-9(8)10/h1-15H;2-4,6-7H,1,5H2 |
| InChIKey | LYKCHJNCHBYQON-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-prop-2-enylbenzene;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-prop-2-enylbenzene;triphenylphosphane?
The IUPAC name of 1-bromo-2-prop-2-enylbenzene;triphenylphosphane (CID 88699732) is 1-bromo-2-prop-2-enylbenzene;triphenylphosphane.
What is the SMILES notation for 1-bromo-2-prop-2-enylbenzene;triphenylphosphane?
The canonical SMILES for 1-bromo-2-prop-2-enylbenzene;triphenylphosphane is C=CCc1ccccc1Br.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-bromo-2-prop-2-enylbenzene;triphenylphosphane?
The InChIKey is LYKCHJNCHBYQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C9H9Br/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-5-8-6-3-4-7-9(8)10/h1-15H;2-4,6-7H,1,5H2.
What are the key properties of 1-bromo-2-prop-2-enylbenzene;triphenylphosphane?
1-bromo-2-prop-2-enylbenzene;triphenylphosphane has a molecular weight of 459.37 g/mol, XLogP of 6.62, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-prop-2-enylbenzene;triphenylphosphane is sourced from PubChem (CID 88699732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).