C9H13ClF3NO2 — CID 88700101
N-[(2S,3R,4S)-6-chloro-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 88700101) has the molecular formula C9H13ClF3NO2 and a molecular weight of 259.66 g/mol. Its IUPAC name is N-[(2S,3R,4S)-6-chloro-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4S)-6-chloro-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88700101 |
| Molecular Formula | C9H13ClF3NO2 |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-[(2S,3R,4S)-6-chloro-2,3-dimethyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1[C@@H](NC(=O)C(F)(F)F)CC(Cl)O[C@H]1C |
| InChI | InChI=1S/C9H13ClF3NO2/c1-4-5(2)16-7(10)3-6(4)14-8(15)9(11,12)13/h4-7H,3H2,1-2H3,(H,14,15)/t4-,5-,6-,7?/m0/s1 |
| InChIKey | JMEWGDMNKVODJC-OGCTWPHMSA-N |
| XLogP | 2.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|