C13H22N2O2S2Si — CID 88700183
2-[[tert-butyl(dimethyl)silyl]sulfamoyl]benzenecarbothioamide (PubChem CID 88700183) has the molecular formula C13H22N2O2S2Si and a molecular weight of 330.55 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 88700183 |
| Molecular Formula | C13H22N2O2S2Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]sulfamoyl]benzenecarbothioamide |
| SMILES | CC(C)(C)[Si](C)(C)NS(=O)(=O)c1ccccc1C(N)=S |
| InChI | InChI=1S/C13H22N2O2S2Si/c1-13(2,3)20(4,5)15-19(16,17)11-9-7-6-8-10(11)12(14)18/h6-9,15H,1-5H3,(H2,14,18) |
| InChIKey | YVDINRVWEVTOLS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|