C7H14N4OS — CID 88700224
N-[(2,3,4-trimethyl-3H-1,2,4-triazol-5-yl)sulfanylmethyl]formamide (PubChem CID 88700224) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is N-[(2,3,4-trimethyl-3H-1,2,4-triazol-5-yl)sulfanylmethyl]formamide.
| Compound Name | N-[(2,3,4-trimethyl-3H-1,2,4-triazol-5-yl)sulfanylmethyl]formamide |
|---|---|
| PubChem CID | 88700224 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-[(2,3,4-trimethyl-3H-1,2,4-triazol-5-yl)sulfanylmethyl]formamide |
| SMILES | CC1N(C)N=C(SCNC=O)N1C |
| InChI | InChI=1S/C7H14N4OS/c1-6-10(2)7(9-11(6)3)13-5-8-4-12/h4,6H,5H2,1-3H3,(H,8,12) |
| InChIKey | VALJHYKEYQKVPL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|