C15H18ClNO4Se — CID 88701038
[4-(2,6-dimethylselenopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate (PubChem CID 88701038) has the molecular formula C15H18ClNO4Se and a molecular weight of 390.73 g/mol. Its IUPAC name is [4-(2,6-dimethylselenopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate.
| Compound Name | [4-(2,6-dimethylselenopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 88701038 |
| Molecular Formula | C15H18ClNO4Se |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | [4-(2,6-dimethylselenopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
| SMILES | CC1=CC(=C2C=CC(=[N+](C)C)C=C2)C=C(C)[Se]1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H18NSe.ClHO4/c1-11-9-14(10-12(2)17-11)13-5-7-15(8-6-13)16(3)4;2-1(3,4)5/h5-10H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | OOOPOGRUXHVFAP-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|