About (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane
(diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane (PubChem CID 88701296) has the molecular formula C9H21O5PS
and a molecular weight of 272.30 g/mol. Its IUPAC name is (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane.
Molecular Properties
| Compound Name | (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane |
| PubChem CID | 88701296 |
| Molecular Formula | C9H21O5PS |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane |
| SMILES | CCS(CC)=P(O)(O)OCC1COCCO1 |
| InChI | InChI=1S/C9H21O5PS/c1-3-16(4-2)15(10,11)14-8-9-7-12-5-6-13-9/h9-11H,3-8H2,1-2H3 |
| InChIKey | PWGRDFWDVBSZFI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane?
The IUPAC name of (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane (CID 88701296) is (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane.
What is the SMILES notation for (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane?
The canonical SMILES for (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane is CCS(CC)=P(O)(O)OCC1COCCO1.
What is the InChIKey of (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane?
The InChIKey is PWGRDFWDVBSZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O5PS/c1-3-16(4-2)15(10,11)14-8-9-7-12-5-6-13-9/h9-11H,3-8H2,1-2H3.
What are the key properties of (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane?
(diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane has a molecular weight of 272.30 g/mol, XLogP of 0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (diethyl-λ4-sulfanylidene)-(1,4-dioxan-2-ylmethoxy)-dihydroxy-λ5-phosphane is sourced from PubChem (CID 88701296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).