C23H30O2 — CID 88701368
(2E,4E,6Z)-4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid (PubChem CID 88701368) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2E,4E,6Z)-4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88701368 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (2E,4E,6Z)-4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid |
| SMILES | C/C(=C/C=C(C)/C=C/C(=O)O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H30O2/c1-16(8-12-21(24)25)7-9-17(2)18-10-11-19-20(15-18)23(5,6)14-13-22(19,3)4/h7-12,15H,13-14H2,1-6H3,(H,24,25)/b12-8+,16-7+,17-9- |
| InChIKey | PQLAGZIEYQKKDY-GLTVKJJJSA-N |
| XLogP | 6.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|