2-fluoro-3-(trifluoromethoxy)benzoyl fluoride

C8H3F5O2 — CID 88701433

IUPAC2-fluoro-3-(trifluoromethoxy)benzoyl fluoride
SMILESO=C(F)c1cccc(OC(F)(F)F)c1F
InChIInChI=1S/C8H3F5O2/c9-6-4(7(10)14)2-1-3-5(6)15-8(11,12)13/h1-3H
InChIKeyCICHUBNDFUQNMR-UHFFFAOYSA-N
MW226.10 g/mol
LogP2.83
Rot. Bonds2

About 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride

2-fluoro-3-(trifluoromethoxy)benzoyl fluoride (PubChem CID 88701433) has the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. Its IUPAC name is 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride.

Molecular Properties

Compound Name2-fluoro-3-(trifluoromethoxy)benzoyl fluoride
PubChem CID88701433
Molecular FormulaC8H3F5O2
Molecular Weight226.10 g/mol
Exact Mass226.01
IUPAC Name2-fluoro-3-(trifluoromethoxy)benzoyl fluoride
SMILESO=C(F)c1cccc(OC(F)(F)F)c1F
InChIInChI=1S/C8H3F5O2/c9-6-4(7(10)14)2-1-3-5(6)15-8(11,12)13/h1-3H
InChIKeyCICHUBNDFUQNMR-UHFFFAOYSA-N
XLogP2.83
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.10
LogP ≤ 52.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride?
The IUPAC name of 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride (CID 88701433) is 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride.
What is the SMILES notation for 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride?
The canonical SMILES for 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride is O=C(F)c1cccc(OC(F)(F)F)c1F.
What is the InChIKey of 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride?
The InChIKey is CICHUBNDFUQNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F5O2/c9-6-4(7(10)14)2-1-3-5(6)15-8(11,12)13/h1-3H.
What are the key properties of 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride?
2-fluoro-3-(trifluoromethoxy)benzoyl fluoride has a molecular weight of 226.10 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-(trifluoromethoxy)benzoyl fluoride is sourced from PubChem (CID 88701433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).