About butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid
butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid (PubChem CID 88701469) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid.
Molecular Properties
| Compound Name | butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid |
| PubChem CID | 88701469 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid |
| SMILES | C/C=C\OC(=O)CC(=O)O.CCCC |
| InChI | InChI=1S/C6H8O4.C4H10/c1-2-3-10-6(9)4-5(7)8;1-3-4-2/h2-3H,4H2,1H3,(H,7,8);3-4H2,1-2H3/b3-2-; |
| InChIKey | WMHCYLLMIZCTNY-OLGQORCHSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid?
The IUPAC name of butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid (CID 88701469) is butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid.
What is the SMILES notation for butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid?
The canonical SMILES for butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid is C/C=C\OC(=O)CC(=O)O.CCCC.
What is the InChIKey of butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid?
The InChIKey is WMHCYLLMIZCTNY-OLGQORCHSA-N. The full InChI is InChI=1S/C6H8O4.C4H10/c1-2-3-10-6(9)4-5(7)8;1-3-4-2/h2-3H,4H2,1H3,(H,7,8);3-4H2,1-2H3/b3-2-;.
What are the key properties of butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid?
butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid has a molecular weight of 202.25 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3-oxo-3-[(Z)-prop-1-enoxy]propanoic acid is sourced from PubChem (CID 88701469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).