About (2-methyl-1,1-dinitropropan-2-yl)benzene
(2-methyl-1,1-dinitropropan-2-yl)benzene (PubChem CID 88701735) has the molecular formula C10H12N2O4
and a molecular weight of 224.22 g/mol. Its IUPAC name is (2-methyl-1,1-dinitropropan-2-yl)benzene.
Molecular Properties
| Compound Name | (2-methyl-1,1-dinitropropan-2-yl)benzene |
| PubChem CID | 88701735 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (2-methyl-1,1-dinitropropan-2-yl)benzene |
| SMILES | CC(C)(c1ccccc1)C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O4/c1-10(2,8-6-4-3-5-7-8)9(11(13)14)12(15)16/h3-7,9H,1-2H3 |
| InChIKey | SCPDOTFVWJKXSF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-1,1-dinitropropan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,1-dinitropropan-2-yl)benzene?
The IUPAC name of (2-methyl-1,1-dinitropropan-2-yl)benzene (CID 88701735) is (2-methyl-1,1-dinitropropan-2-yl)benzene.
What is the SMILES notation for (2-methyl-1,1-dinitropropan-2-yl)benzene?
The canonical SMILES for (2-methyl-1,1-dinitropropan-2-yl)benzene is CC(C)(c1ccccc1)C([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of (2-methyl-1,1-dinitropropan-2-yl)benzene?
The InChIKey is SCPDOTFVWJKXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-10(2,8-6-4-3-5-7-8)9(11(13)14)12(15)16/h3-7,9H,1-2H3.
What are the key properties of (2-methyl-1,1-dinitropropan-2-yl)benzene?
(2-methyl-1,1-dinitropropan-2-yl)benzene has a molecular weight of 224.22 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,1-dinitropropan-2-yl)benzene is sourced from PubChem (CID 88701735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).